C14H21FN2O3S — CID 104830380
N-(3,3-dimethylbutan-2-yl)-2-fluoro-3-methyl-5-sulfamoylbenzamide (PubChem CID 104830380) has the molecular formula C14H21FN2O3S and a molecular weight of 316.40 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-2-fluoro-3-methyl-5-sulfamoylbenzamide.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-2-fluoro-3-methyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 104830380 |
| Molecular Formula | C14H21FN2O3S |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-2-fluoro-3-methyl-5-sulfamoylbenzamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(C(=O)NC(C)C(C)(C)C)c1F |
| InChI | InChI=1S/C14H21FN2O3S/c1-8-6-10(21(16,19)20)7-11(12(8)15)13(18)17-9(2)14(3,4)5/h6-7,9H,1-5H3,(H,17,18)(H2,16,19,20) |
| InChIKey | CFKKGXRTIQHXIN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |