C13H20N2O3S — CID 46651162
2-methyl-N-(3-methylbutan-2-yl)-5-sulfamoylbenzamide (PubChem CID 46651162) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-methyl-N-(3-methylbutan-2-yl)-5-sulfamoylbenzamide.
| Compound Name | 2-methyl-N-(3-methylbutan-2-yl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 46651162 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-methyl-N-(3-methylbutan-2-yl)-5-sulfamoylbenzamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)NC(C)C(C)C |
| InChI | InChI=1S/C13H20N2O3S/c1-8(2)10(4)15-13(16)12-7-11(19(14,17)18)6-5-9(12)3/h5-8,10H,1-4H3,(H,15,16)(H2,14,17,18) |
| InChIKey | PWTVZJCPEDAFFS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |