C16H26N2O3S — CID 46515920
2-methyl-N-(6-methylheptan-2-yl)-5-sulfamoylbenzamide (PubChem CID 46515920) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is 2-methyl-N-(6-methylheptan-2-yl)-5-sulfamoylbenzamide.
| Compound Name | 2-methyl-N-(6-methylheptan-2-yl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 46515920 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2-methyl-N-(6-methylheptan-2-yl)-5-sulfamoylbenzamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)NC(C)CCCC(C)C |
| InChI | InChI=1S/C16H26N2O3S/c1-11(2)6-5-7-13(4)18-16(19)15-10-14(22(17,20)21)9-8-12(15)3/h8-11,13H,5-7H2,1-4H3,(H,18,19)(H2,17,20,21) |
| InChIKey | RTCZNSDPSHDUPM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |