C17H25FN2O5S — CID 46608312
[2-(6-methylheptan-2-ylamino)-2-oxoethyl] 2-fluoro-5-sulfamoylbenzoate (PubChem CID 46608312) has the molecular formula C17H25FN2O5S and a molecular weight of 388.46 g/mol. Its IUPAC name is [2-(6-methylheptan-2-ylamino)-2-oxoethyl] 2-fluoro-5-sulfamoylbenzoate.
| Compound Name | [2-(6-methylheptan-2-ylamino)-2-oxoethyl] 2-fluoro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 46608312 |
| Molecular Formula | C17H25FN2O5S |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | [2-(6-methylheptan-2-ylamino)-2-oxoethyl] 2-fluoro-5-sulfamoylbenzoate |
| SMILES | CC(C)CCCC(C)NC(=O)COC(=O)c1cc(S(N)(=O)=O)ccc1F |
| InChI | InChI=1S/C17H25FN2O5S/c1-11(2)5-4-6-12(3)20-16(21)10-25-17(22)14-9-13(26(19,23)24)7-8-15(14)18/h7-9,11-12H,4-6,10H2,1-3H3,(H,20,21)(H2,19,23,24) |
| InChIKey | GNTXHUNLVGFTHL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |