C18H27NO5 — CID 18201495
[2-(6-methylheptan-2-ylamino)-2-oxoethyl] 2-hydroxy-4-methoxybenzoate (PubChem CID 18201495) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is [2-(6-methylheptan-2-ylamino)-2-oxoethyl] 2-hydroxy-4-methoxybenzoate.
| Compound Name | [2-(6-methylheptan-2-ylamino)-2-oxoethyl] 2-hydroxy-4-methoxybenzoate |
|---|---|
| PubChem CID | 18201495 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | [2-(6-methylheptan-2-ylamino)-2-oxoethyl] 2-hydroxy-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)NC(C)CCCC(C)C)c(O)c1 |
| InChI | InChI=1S/C18H27NO5/c1-12(2)6-5-7-13(3)19-17(21)11-24-18(22)15-9-8-14(23-4)10-16(15)20/h8-10,12-13,20H,5-7,11H2,1-4H3,(H,19,21) |
| InChIKey | ZXPHIZNOVIDWCI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |