C17H17NO7 — CID 2645350
[2-(2,4-dimethoxyanilino)-2-oxoethyl] 2,4-dihydroxybenzoate (PubChem CID 2645350) has the molecular formula C17H17NO7 and a molecular weight of 347.32 g/mol. Its IUPAC name is [2-(2,4-dimethoxyanilino)-2-oxoethyl] 2,4-dihydroxybenzoate.
| Compound Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 2645350 |
| Molecular Formula | C17H17NO7 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 2,4-dihydroxybenzoate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2ccc(O)cc2O)c(OC)c1 |
| InChI | InChI=1S/C17H17NO7/c1-23-11-4-6-13(15(8-11)24-2)18-16(21)9-25-17(22)12-5-3-10(19)7-14(12)20/h3-8,19-20H,9H2,1-2H3,(H,18,21) |
| InChIKey | WZTRBENKZRGWRQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |