C21H21NO9 — CID 2505044
dimethyl 2-[[2-(2,4-dimethoxybenzoyl)oxyacetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 2505044) has the molecular formula C21H21NO9 and a molecular weight of 431.40 g/mol. Its IUPAC name is dimethyl 2-[[2-(2,4-dimethoxybenzoyl)oxyacetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-(2,4-dimethoxybenzoyl)oxyacetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 2505044 |
| Molecular Formula | C21H21NO9 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | dimethyl 2-[[2-(2,4-dimethoxybenzoyl)oxyacetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)COC(=O)c2ccc(OC)cc2OC)c1 |
| InChI | InChI=1S/C21H21NO9/c1-27-13-6-8-15(17(10-13)28-2)21(26)31-11-18(23)22-16-9-12(19(24)29-3)5-7-14(16)20(25)30-4/h5-10H,11H2,1-4H3,(H,22,23) |
| InChIKey | RVTNRRVBOWSSIP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|