C13H16N2O6 — CID 2504725
[2-(methylcarbamoylamino)-2-oxoethyl] 2,4-dimethoxybenzoate (PubChem CID 2504725) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 2,4-dimethoxybenzoate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 2504725 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2,4-dimethoxybenzoate |
| SMILES | CNC(=O)NC(=O)COC(=O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C13H16N2O6/c1-14-13(18)15-11(16)7-21-12(17)9-5-4-8(19-2)6-10(9)20-3/h4-6H,7H2,1-3H3,(H2,14,15,16,18) |
| InChIKey | KBZJOOMEZXBZOJ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |