C14H17NO7 — CID 7561154
[2-(ethoxycarbonylamino)-2-oxoethyl] 2,5-dimethoxybenzoate (PubChem CID 7561154) has the molecular formula C14H17NO7 and a molecular weight of 311.29 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 2,5-dimethoxybenzoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 7561154 |
| Molecular Formula | C14H17NO7 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2,5-dimethoxybenzoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C14H17NO7/c1-4-21-14(18)15-12(16)8-22-13(17)10-7-9(19-2)5-6-11(10)20-3/h5-7H,4,8H2,1-3H3,(H,15,16,18) |
| InChIKey | HJWHHWYEVSNSLI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |