C18H25NO5 — CID 7561176
[2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2,5-dimethoxybenzoate (PubChem CID 7561176) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2,5-dimethoxybenzoate.
| Compound Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 7561176 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2,5-dimethoxybenzoate |
| SMILES | COc1ccc(OC)c(C(=O)OCC(=O)NC2CCC(C)CC2)c1 |
| InChI | InChI=1S/C18H25NO5/c1-12-4-6-13(7-5-12)19-17(20)11-24-18(21)15-10-14(22-2)8-9-16(15)23-3/h8-10,12-13H,4-7,11H2,1-3H3,(H,19,20) |
| InChIKey | PKUXCPOOLXSYLQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |