C13H14FNO4 — CID 7887546
[2-(cyclopropylamino)-2-oxoethyl] 2-fluoro-4-methoxybenzoate (PubChem CID 7887546) has the molecular formula C13H14FNO4 and a molecular weight of 267.26 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 2-fluoro-4-methoxybenzoate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 2-fluoro-4-methoxybenzoate |
|---|---|
| PubChem CID | 7887546 |
| Molecular Formula | C13H14FNO4 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 2-fluoro-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)NC2CC2)c(F)c1 |
| InChI | InChI=1S/C13H14FNO4/c1-18-9-4-5-10(11(14)6-9)13(17)19-7-12(16)15-8-2-3-8/h4-6,8H,2-3,7H2,1H3,(H,15,16) |
| InChIKey | XKERCRYULMKXTM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |