C15H18FNO5 — CID 8509177
[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 2-fluoro-4-methoxybenzoate (PubChem CID 8509177) has the molecular formula C15H18FNO5 and a molecular weight of 311.31 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 2-fluoro-4-methoxybenzoate.
| Compound Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 2-fluoro-4-methoxybenzoate |
|---|---|
| PubChem CID | 8509177 |
| Molecular Formula | C15H18FNO5 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 2-fluoro-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)NC[C@@H]2CCCO2)c(F)c1 |
| InChI | InChI=1S/C15H18FNO5/c1-20-10-4-5-12(13(16)7-10)15(19)22-9-14(18)17-8-11-3-2-6-21-11/h4-5,7,11H,2-3,6,8-9H2,1H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | WNNCMVYUHKCIHX-NSHDSACASA-N |
| XLogP | 1.29 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |