C16H21NO6 — CID 8011905
[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 3,4-dimethoxybenzoate (PubChem CID 8011905) has the molecular formula C16H21NO6 and a molecular weight of 323.34 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 3,4-dimethoxybenzoate.
| Compound Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 8011905 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)NC[C@@H]2CCCO2)cc1OC |
| InChI | InChI=1S/C16H21NO6/c1-20-13-6-5-11(8-14(13)21-2)16(19)23-10-15(18)17-9-12-4-3-7-22-12/h5-6,8,12H,3-4,7,9-10H2,1-2H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | MWDTYFRCFYBNPV-LBPRGKRZSA-N |
| XLogP | 1.16 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |