C16H21NO6 — CID 23910544
[2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2,6-dimethoxybenzoate (PubChem CID 23910544) has the molecular formula C16H21NO6 and a molecular weight of 323.34 g/mol. Its IUPAC name is [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2,6-dimethoxybenzoate.
| Compound Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 23910544 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2,6-dimethoxybenzoate |
| SMILES | COc1cccc(OC)c1C(=O)OCC(=O)NCC1CCCO1 |
| InChI | InChI=1S/C16H21NO6/c1-20-12-6-3-7-13(21-2)15(12)16(19)23-10-14(18)17-9-11-5-4-8-22-11/h3,6-7,11H,4-5,8-10H2,1-2H3,(H,17,18) |
| InChIKey | KNCUDZAAXDLPSQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |