C14H15Cl2NO4 — CID 2487426
[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2,3-dichlorobenzoate (PubChem CID 2487426) has the molecular formula C14H15Cl2NO4 and a molecular weight of 332.18 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2,3-dichlorobenzoate.
| Compound Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2,3-dichlorobenzoate |
|---|---|
| PubChem CID | 2487426 |
| Molecular Formula | C14H15Cl2NO4 |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2,3-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1cccc(Cl)c1Cl)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C14H15Cl2NO4/c15-11-5-1-4-10(13(11)16)14(19)21-8-12(18)17-7-9-3-2-6-20-9/h1,4-5,9H,2-3,6-8H2,(H,17,18)/t9-/m1/s1 |
| InChIKey | WAMMPLQREKTHKG-SECBINFHSA-N |
| XLogP | 2.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |