C12H14ClNO2 — CID 668841
2-chloro-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 668841) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is 2-chloro-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 2-chloro-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 668841 |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 2-chloro-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | O=C(NC[C@@H]1CCCO1)c1ccccc1Cl |
| InChI | InChI=1S/C12H14ClNO2/c13-11-6-2-1-5-10(11)12(15)14-8-9-4-3-7-16-9/h1-2,5-6,9H,3-4,7-8H2,(H,14,15)/t9-/m0/s1 |
| InChIKey | HOJRGAVTPWHWKA-VIFPVBQESA-N |
| XLogP | 2.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |