C18H21ClN3O2+ — CID 6986382
2-[(2-chlorophenyl)methylamino]-N-[[(2R)-oxolan-2-yl]methyl]pyridin-1-ium-3-carboxamide (PubChem CID 6986382) has the molecular formula C18H21ClN3O2+ and a molecular weight of 346.84 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylamino]-N-[[(2R)-oxolan-2-yl]methyl]pyridin-1-ium-3-carboxamide.
| Compound Name | 2-[(2-chlorophenyl)methylamino]-N-[[(2R)-oxolan-2-yl]methyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 6986382 |
| Molecular Formula | C18H21ClN3O2+ |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2-[(2-chlorophenyl)methylamino]-N-[[(2R)-oxolan-2-yl]methyl]pyridin-1-ium-3-carboxamide |
| SMILES | O=C(NC[C@H]1CCCO1)c1ccc[nH+]c1NCc1ccccc1Cl |
| InChI | InChI=1S/C18H20ClN3O2/c19-16-8-2-1-5-13(16)11-21-17-15(7-3-9-20-17)18(23)22-12-14-6-4-10-24-14/h1-3,5,7-9,14H,4,6,10-12H2,(H,20,21)(H,22,23)/p+1/t14-/m1/s1 |
| InChIKey | VXCVXCYUVMYYOQ-CQSZACIVSA-O |
| XLogP | 2.67 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |