C20H22ClN3O5S — CID 134603951
4-[[2-(2-chlorophenyl)acetyl]amino]-N-[[(2R)-oxolan-2-yl]methyl]-2-sulfamoylbenzamide (PubChem CID 134603951) has the molecular formula C20H22ClN3O5S and a molecular weight of 451.93 g/mol. Its IUPAC name is 4-[[2-(2-chlorophenyl)acetyl]amino]-N-[[(2R)-oxolan-2-yl]methyl]-2-sulfamoylbenzamide.
| Compound Name | 4-[[2-(2-chlorophenyl)acetyl]amino]-N-[[(2R)-oxolan-2-yl]methyl]-2-sulfamoylbenzamide |
|---|---|
| PubChem CID | 134603951 |
| Molecular Formula | C20H22ClN3O5S |
| Molecular Weight | 451.93 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 4-[[2-(2-chlorophenyl)acetyl]amino]-N-[[(2R)-oxolan-2-yl]methyl]-2-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1cc(NC(=O)Cc2ccccc2Cl)ccc1C(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C20H22ClN3O5S/c21-17-6-2-1-4-13(17)10-19(25)24-14-7-8-16(18(11-14)30(22,27)28)20(26)23-12-15-5-3-9-29-15/h1-2,4,6-8,11,15H,3,5,9-10,12H2,(H,23,26)(H,24,25)(H2,22,27,28)/t15-/m1/s1 |
| InChIKey | KPMZJKVLYLIGNA-OAHLLOKOSA-N |
| XLogP | 2.08 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.93 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |