C19H21ClN4O5S — CID 134603941
4-[[2-(3-chloro-4-pyridinyl)acetyl]amino]-N-(oxolan-3-ylmethyl)-2-sulfamoylbenzamide (PubChem CID 134603941) has the molecular formula C19H21ClN4O5S and a molecular weight of 452.92 g/mol. Its IUPAC name is 4-[[2-(3-chloro-4-pyridinyl)acetyl]amino]-N-(oxolan-3-ylmethyl)-2-sulfamoylbenzamide.
| Compound Name | 4-[[2-(3-chloro-4-pyridinyl)acetyl]amino]-N-(oxolan-3-ylmethyl)-2-sulfamoylbenzamide |
|---|---|
| PubChem CID | 134603941 |
| Molecular Formula | C19H21ClN4O5S |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 4-[[2-(3-chloro-4-pyridinyl)acetyl]amino]-N-(oxolan-3-ylmethyl)-2-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1cc(NC(=O)Cc2ccncc2Cl)ccc1C(=O)NCC1CCOC1 |
| InChI | InChI=1S/C19H21ClN4O5S/c20-16-10-22-5-3-13(16)7-18(25)24-14-1-2-15(17(8-14)30(21,27)28)19(26)23-9-12-4-6-29-11-12/h1-3,5,8,10,12H,4,6-7,9,11H2,(H,23,26)(H,24,25)(H2,21,27,28) |
| InChIKey | UPXGPTFIXPIXQL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 140.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |