C12H15NO4 — CID 103614166
2,4-dihydroxy-N-(oxolan-3-ylmethyl)benzamide (PubChem CID 103614166) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is 2,4-dihydroxy-N-(oxolan-3-ylmethyl)benzamide.
| Compound Name | 2,4-dihydroxy-N-(oxolan-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 103614166 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2,4-dihydroxy-N-(oxolan-3-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCOC1)c1ccc(O)cc1O |
| InChI | InChI=1S/C12H15NO4/c14-9-1-2-10(11(15)5-9)12(16)13-6-8-3-4-17-7-8/h1-2,5,8,14-15H,3-4,6-7H2,(H,13,16) |
| InChIKey | GAVMZOQZUUEDDR-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |