C13H16FNO3 — CID 113222377
2-fluoro-4-methoxy-N-(oxolan-3-ylmethyl)benzamide (PubChem CID 113222377) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is 2-fluoro-4-methoxy-N-(oxolan-3-ylmethyl)benzamide.
| Compound Name | 2-fluoro-4-methoxy-N-(oxolan-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 113222377 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-fluoro-4-methoxy-N-(oxolan-3-ylmethyl)benzamide |
| SMILES | COc1ccc(C(=O)NCC2CCOC2)c(F)c1 |
| InChI | InChI=1S/C13H16FNO3/c1-17-10-2-3-11(12(14)6-10)13(16)15-7-9-4-5-18-8-9/h2-3,6,9H,4-5,7-8H2,1H3,(H,15,16) |
| InChIKey | IUVXEZANMUHARF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |