C15H19F3N2O3 — CID 95323347
1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]-3-[[(3S)-oxolan-3-yl]methyl]urea (PubChem CID 95323347) has the molecular formula C15H19F3N2O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is 1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]-3-[[(3S)-oxolan-3-yl]methyl]urea.
| Compound Name | 1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]-3-[[(3S)-oxolan-3-yl]methyl]urea |
|---|---|
| PubChem CID | 95323347 |
| Molecular Formula | C15H19F3N2O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]-3-[[(3S)-oxolan-3-yl]methyl]urea |
| SMILES | COc1ccc(CNC(=O)NC[C@@H]2CCOC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19F3N2O3/c1-22-12-3-2-11(13(6-12)15(16,17)18)8-20-14(21)19-7-10-4-5-23-9-10/h2-3,6,10H,4-5,7-9H2,1H3,(H2,19,20,21)/t10-/m0/s1 |
| InChIKey | RCSZFZLUIUQIHA-JTQLQIEISA-N |
| XLogP | 2.55 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |