C18H27N3O3 — CID 98760898
1-[[(3S)-1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-3-[[(3R)-oxolan-3-yl]methyl]urea (PubChem CID 98760898) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is 1-[[(3S)-1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-3-[[(3R)-oxolan-3-yl]methyl]urea.
| Compound Name | 1-[[(3S)-1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-3-[[(3R)-oxolan-3-yl]methyl]urea |
|---|---|
| PubChem CID | 98760898 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 1-[[(3S)-1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-3-[[(3R)-oxolan-3-yl]methyl]urea |
| SMILES | COc1cccc(N2CC[C@@H](CNC(=O)NC[C@H]3CCOC3)C2)c1 |
| InChI | InChI=1S/C18H27N3O3/c1-23-17-4-2-3-16(9-17)21-7-5-14(12-21)10-19-18(22)20-11-15-6-8-24-13-15/h2-4,9,14-15H,5-8,10-13H2,1H3,(H2,19,20,22)/t14-,15+/m0/s1 |
| InChIKey | NPHPYHXJPGSNRR-LSDHHAIUSA-N |
| XLogP | 1.86 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |