C20H29N3O2 — CID 95300449
1-(dicyclopropylmethyl)-3-[[(3S)-1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]urea (PubChem CID 95300449) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-(dicyclopropylmethyl)-3-[[(3S)-1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]urea.
| Compound Name | 1-(dicyclopropylmethyl)-3-[[(3S)-1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 95300449 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 1-(dicyclopropylmethyl)-3-[[(3S)-1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]urea |
| SMILES | COc1cccc(N2CC[C@@H](CNC(=O)NC(C3CC3)C3CC3)C2)c1 |
| InChI | InChI=1S/C20H29N3O2/c1-25-18-4-2-3-17(11-18)23-10-9-14(13-23)12-21-20(24)22-19(15-5-6-15)16-7-8-16/h2-4,11,14-16,19H,5-10,12-13H2,1H3,(H2,21,22,24)/t14-/m0/s1 |
| InChIKey | GEGITLJVOPWIBV-AWEZNQCLSA-N |
| XLogP | 3.01 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |