C19H29N3O3 — CID 95300487
1-(4-hydroxycyclohexyl)-3-[[(3S)-1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]urea (PubChem CID 95300487) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is 1-(4-hydroxycyclohexyl)-3-[[(3S)-1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]urea.
| Compound Name | 1-(4-hydroxycyclohexyl)-3-[[(3S)-1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 95300487 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 1-(4-hydroxycyclohexyl)-3-[[(3S)-1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]urea |
| SMILES | COc1cccc(N2CC[C@@H](CNC(=O)NC3CCC(O)CC3)C2)c1 |
| InChI | InChI=1S/C19H29N3O3/c1-25-18-4-2-3-16(11-18)22-10-9-14(13-22)12-20-19(24)21-15-5-7-17(23)8-6-15/h2-4,11,14-15,17,23H,5-10,12-13H2,1H3,(H2,20,21,24)/t14-,15?,17?/m0/s1 |
| InChIKey | ZKUADSLMOSLKLP-UQPPLGOBSA-N |
| XLogP | 2.12 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |