C21H32N4O3 — CID 136526374
1-[(1-acetylpiperidin-4-yl)methyl]-3-[1-(3-methoxyphenyl)piperidin-3-yl]urea (PubChem CID 136526374) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 1-[(1-acetylpiperidin-4-yl)methyl]-3-[1-(3-methoxyphenyl)piperidin-3-yl]urea.
| Compound Name | 1-[(1-acetylpiperidin-4-yl)methyl]-3-[1-(3-methoxyphenyl)piperidin-3-yl]urea |
|---|---|
| PubChem CID | 136526374 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 1-[(1-acetylpiperidin-4-yl)methyl]-3-[1-(3-methoxyphenyl)piperidin-3-yl]urea |
| SMILES | COc1cccc(N2CCCC(NC(=O)NCC3CCN(C(C)=O)CC3)C2)c1 |
| InChI | InChI=1S/C21H32N4O3/c1-16(26)24-11-8-17(9-12-24)14-22-21(27)23-18-5-4-10-25(15-18)19-6-3-7-20(13-19)28-2/h3,6-7,13,17-18H,4-5,8-12,14-15H2,1-2H3,(H2,22,23,27) |
| InChIKey | MQZUTKRIHBKCRB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |