C17H25N3O4 — CID 122000111
3-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methylcarbamoyl-methylamino]propanoic acid (PubChem CID 122000111) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 3-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methylcarbamoyl-methylamino]propanoic acid.
| Compound Name | 3-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methylcarbamoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 122000111 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 3-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methylcarbamoyl-methylamino]propanoic acid |
| SMILES | COc1cccc(N2CCC(CNC(=O)N(C)CCC(=O)O)C2)c1 |
| InChI | InChI=1S/C17H25N3O4/c1-19(8-7-16(21)22)17(23)18-11-13-6-9-20(12-13)14-4-3-5-15(10-14)24-2/h3-5,10,13H,6-9,11-12H2,1-2H3,(H,18,23)(H,21,22) |
| InChIKey | XUDIPTUDZURWHJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |