C20H30F3N3O2 — CID 109386515
1,2-dimethyl-3-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109386515) has the molecular formula C20H30F3N3O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 1,2-dimethyl-3-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 1,2-dimethyl-3-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109386515 |
| Molecular Formula | C20H30F3N3O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 1,2-dimethyl-3-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | C/N=C(/NCc1ccc(OC(C)(C)C)cc1C(F)(F)F)N(C)CC1CCOC1 |
| InChI | InChI=1S/C20H30F3N3O2/c1-19(2,3)28-16-7-6-15(17(10-16)20(21,22)23)11-25-18(24-4)26(5)12-14-8-9-27-13-14/h6-7,10,14H,8-9,11-13H2,1-5H3,(H,24,25) |
| InChIKey | FKHIACJFRCXFON-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|