C16H24F2IN3O2 — CID 109383861
3-[[2-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109383861) has the molecular formula C16H24F2IN3O2 and a molecular weight of 455.29 g/mol. Its IUPAC name is 3-[[2-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-[[2-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109383861 |
| Molecular Formula | C16H24F2IN3O2 |
| Molecular Weight | 455.29 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 3-[[2-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccccc1OC(F)F)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C16H23F2N3O2.HI/c1-19-16(21(2)10-12-7-8-22-11-12)20-9-13-5-3-4-6-14(13)23-15(17)18;/h3-6,12,15H,7-11H2,1-2H3,(H,19,20);1H |
| InChIKey | DWHOEIRVAWALAP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|