C16H25ClIN3O2 — CID 109382189
3-[2-(2-chlorophenoxy)ethyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109382189) has the molecular formula C16H25ClIN3O2 and a molecular weight of 453.75 g/mol. Its IUPAC name is 3-[2-(2-chlorophenoxy)ethyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-[2-(2-chlorophenoxy)ethyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109382189 |
| Molecular Formula | C16H25ClIN3O2 |
| Molecular Weight | 453.75 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 3-[2-(2-chlorophenoxy)ethyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCOc1ccccc1Cl)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C16H24ClN3O2.HI/c1-18-16(20(2)11-13-7-9-21-12-13)19-8-10-22-15-6-4-3-5-14(15)17;/h3-6,13H,7-12H2,1-2H3,(H,18,19);1H |
| InChIKey | OMCSRCKVDCDZKS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.75 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|