C17H28IN3O2 — CID 109382355
1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-(3-phenoxypropyl)guanidine;hydroiodide (PubChem CID 109382355) has the molecular formula C17H28IN3O2 and a molecular weight of 433.33 g/mol. Its IUPAC name is 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-(3-phenoxypropyl)guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-(3-phenoxypropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109382355 |
| Molecular Formula | C17H28IN3O2 |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-(3-phenoxypropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCOc1ccccc1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C17H27N3O2.HI/c1-18-17(20(2)13-15-9-12-21-14-15)19-10-6-11-22-16-7-4-3-5-8-16;/h3-5,7-8,15H,6,9-14H2,1-2H3,(H,18,19);1H |
| InChIKey | WJGNAFCQEKUKEF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|