C11H23FIN3O — CID 109384464
3-(3-fluoropropyl)-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109384464) has the molecular formula C11H23FIN3O and a molecular weight of 359.23 g/mol. Its IUPAC name is 3-(3-fluoropropyl)-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-(3-fluoropropyl)-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109384464 |
| Molecular Formula | C11H23FIN3O |
| Molecular Weight | 359.23 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 3-(3-fluoropropyl)-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCF)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C11H22FN3O.HI/c1-13-11(14-6-3-5-12)15(2)8-10-4-7-16-9-10;/h10H,3-9H2,1-2H3,(H,13,14);1H |
| InChIKey | YEODLMDHPDWWPF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|