C11H24IN3OS — CID 109382973
1,2-dimethyl-3-(2-methylsulfanylethyl)-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109382973) has the molecular formula C11H24IN3OS and a molecular weight of 373.30 g/mol. Its IUPAC name is 1,2-dimethyl-3-(2-methylsulfanylethyl)-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-(2-methylsulfanylethyl)-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109382973 |
| Molecular Formula | C11H24IN3OS |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 1,2-dimethyl-3-(2-methylsulfanylethyl)-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCSC)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C11H23N3OS.HI/c1-12-11(13-5-7-16-3)14(2)8-10-4-6-15-9-10;/h10H,4-9H2,1-3H3,(H,12,13);1H |
| InChIKey | VMXJNDGUVRQWRV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|