C20H35N3O — CID 109381598
3-[2-(1-adamantyl)ethyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109381598) has the molecular formula C20H35N3O and a molecular weight of 333.52 g/mol. Its IUPAC name is 3-[2-(1-adamantyl)ethyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 3-[2-(1-adamantyl)ethyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109381598 |
| Molecular Formula | C20H35N3O |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.28 |
| IUPAC Name | 3-[2-(1-adamantyl)ethyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | C/N=C(/NCCC12CC3CC(CC(C3)C1)C2)N(C)CC1CCOC1 |
| InChI | InChI=1S/C20H35N3O/c1-21-19(23(2)13-15-3-6-24-14-15)22-5-4-20-10-16-7-17(11-20)9-18(8-16)12-20/h15-18H,3-14H2,1-2H3,(H,21,22) |
| InChIKey | YCLOONHIFJLYMC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|