C17H25F2N3O3 — CID 109381704
3-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109381704) has the molecular formula C17H25F2N3O3 and a molecular weight of 357.40 g/mol. Its IUPAC name is 3-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 3-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109381704 |
| Molecular Formula | C17H25F2N3O3 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 3-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | C/N=C(/NCc1ccc(OC)c(OC(F)F)c1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C17H25F2N3O3/c1-20-17(22(2)10-13-6-7-24-11-13)21-9-12-4-5-14(23-3)15(8-12)25-16(18)19/h4-5,8,13,16H,6-7,9-11H2,1-3H3,(H,20,21) |
| InChIKey | ITHCMVUJMXHURG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|