C18H28F2IN3O3 — CID 109386378
2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109386378) has the molecular formula C18H28F2IN3O3 and a molecular weight of 499.34 g/mol. Its IUPAC name is 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109386378 |
| Molecular Formula | C18H28F2IN3O3 |
| Molecular Weight | 499.34 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC(F)F)c1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C18H27F2N3O3.HI/c1-4-21-18(23(2)11-14-7-8-25-12-14)22-10-13-5-6-15(24-3)16(9-13)26-17(19)20;/h5-6,9,14,17H,4,7-8,10-12H2,1-3H3,(H,21,22);1H |
| InChIKey | RWMLHZWPVTZLSE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|