C18H29BrIN3O3 — CID 109384971
2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109384971) has the molecular formula C18H29BrIN3O3 and a molecular weight of 542.26 g/mol. Its IUPAC name is 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109384971 |
| Molecular Formula | C18H29BrIN3O3 |
| Molecular Weight | 542.26 g/mol |
| Exact Mass | 541.04 |
| IUPAC Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)cc1Br)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C18H28BrN3O3.HI/c1-5-20-18(22(2)11-13-6-7-25-12-13)21-10-14-8-16(23-3)17(24-4)9-15(14)19;/h8-9,13H,5-7,10-12H2,1-4H3,(H,20,21);1H |
| InChIKey | KVYCQVTYMZEIPQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|