C20H34IN3O4 — CID 109386106
3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[2-(2,4,6-trimethoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 109386106) has the molecular formula C20H34IN3O4 and a molecular weight of 507.41 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[2-(2,4,6-trimethoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[2-(2,4,6-trimethoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109386106 |
| Molecular Formula | C20H34IN3O4 |
| Molecular Weight | 507.41 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[2-(2,4,6-trimethoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1c(OC)cc(OC)cc1OC)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C20H33N3O4.HI/c1-6-21-20(23(2)13-15-8-10-27-14-15)22-9-7-17-18(25-4)11-16(24-3)12-19(17)26-5;/h11-12,15H,6-10,13-14H2,1-5H3,(H,21,22);1H |
| InChIKey | CEKDTSALWVVVQP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 64.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|