C23H30FN3O2 — CID 109384802
3-ethyl-2-[2-(3-fluoro-4-phenoxyphenyl)ethyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109384802) has the molecular formula C23H30FN3O2 and a molecular weight of 399.51 g/mol. Its IUPAC name is 3-ethyl-2-[2-(3-fluoro-4-phenoxyphenyl)ethyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 3-ethyl-2-[2-(3-fluoro-4-phenoxyphenyl)ethyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109384802 |
| Molecular Formula | C23H30FN3O2 |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 3-ethyl-2-[2-(3-fluoro-4-phenoxyphenyl)ethyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\CCc1ccc(Oc2ccccc2)c(F)c1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C23H30FN3O2/c1-3-25-23(27(2)16-19-12-14-28-17-19)26-13-11-18-9-10-22(21(24)15-18)29-20-7-5-4-6-8-20/h4-10,15,19H,3,11-14,16-17H2,1-2H3,(H,25,26) |
| InChIKey | GDQHXRGOUXLGDC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|