C17H26F2IN3O2 — CID 109384097
2-[2-(3,4-difluorophenoxy)ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109384097) has the molecular formula C17H26F2IN3O2 and a molecular weight of 469.31 g/mol. Its IUPAC name is 2-[2-(3,4-difluorophenoxy)ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(3,4-difluorophenoxy)ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109384097 |
| Molecular Formula | C17H26F2IN3O2 |
| Molecular Weight | 469.31 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 2-[2-(3,4-difluorophenoxy)ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCOc1ccc(F)c(F)c1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C17H25F2N3O2.HI/c1-3-20-17(22(2)11-13-6-8-23-12-13)21-7-9-24-14-4-5-15(18)16(19)10-14;/h4-5,10,13H,3,6-9,11-12H2,1-2H3,(H,20,21);1H |
| InChIKey | YIGKMFOIEMZONE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|