C19H31BrIN3O2S — CID 109386792
2-[2-[2-(3-bromophenoxy)ethylsulfanyl]ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109386792) has the molecular formula C19H31BrIN3O2S and a molecular weight of 572.35 g/mol. Its IUPAC name is 2-[2-[2-(3-bromophenoxy)ethylsulfanyl]ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[2-[2-(3-bromophenoxy)ethylsulfanyl]ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109386792 |
| Molecular Formula | C19H31BrIN3O2S |
| Molecular Weight | 572.35 g/mol |
| Exact Mass | 571.04 |
| IUPAC Name | 2-[2-[2-(3-bromophenoxy)ethylsulfanyl]ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCSCCOc1cccc(Br)c1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C19H30BrN3O2S.HI/c1-3-21-19(23(2)14-16-7-9-24-15-16)22-8-11-26-12-10-25-18-6-4-5-17(20)13-18;/h4-6,13,16H,3,7-12,14-15H2,1-2H3,(H,21,22);1H |
| InChIKey | ULVARFVWTSBZPR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|