C18H27F3IN3O2 — CID 109384829
3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[2-[2-(trifluoromethyl)phenoxy]ethyl]guanidine;hydroiodide (PubChem CID 109384829) has the molecular formula C18H27F3IN3O2 and a molecular weight of 501.33 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[2-[2-(trifluoromethyl)phenoxy]ethyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[2-[2-(trifluoromethyl)phenoxy]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109384829 |
| Molecular Formula | C18H27F3IN3O2 |
| Molecular Weight | 501.33 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[2-[2-(trifluoromethyl)phenoxy]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCOc1ccccc1C(F)(F)F)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C18H26F3N3O2.HI/c1-3-22-17(24(2)12-14-8-10-25-13-14)23-9-11-26-16-7-5-4-6-15(16)18(19,20)21;/h4-7,14H,3,8-13H2,1-2H3,(H,22,23);1H |
| InChIKey | VJMOLQYXOINFOU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|