C21H36IN3O — CID 109386804
3-ethyl-2-(2-ethyl-2-phenylbutyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109386804) has the molecular formula C21H36IN3O and a molecular weight of 473.44 g/mol. Its IUPAC name is 3-ethyl-2-(2-ethyl-2-phenylbutyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-ethyl-2-(2-ethyl-2-phenylbutyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109386804 |
| Molecular Formula | C21H36IN3O |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 3-ethyl-2-(2-ethyl-2-phenylbutyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CC)(CC)c1ccccc1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C21H35N3O.HI/c1-5-21(6-2,19-11-9-8-10-12-19)17-23-20(22-7-3)24(4)15-18-13-14-25-16-18;/h8-12,18H,5-7,13-17H2,1-4H3,(H,22,23);1H |
| InChIKey | BHESKBWOTFKNRO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|