C18H27IN4O — CID 109385708
3-ethyl-2-(1H-indol-2-ylmethyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109385708) has the molecular formula C18H27IN4O and a molecular weight of 442.35 g/mol. Its IUPAC name is 3-ethyl-2-(1H-indol-2-ylmethyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-ethyl-2-(1H-indol-2-ylmethyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109385708 |
| Molecular Formula | C18H27IN4O |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 3-ethyl-2-(1H-indol-2-ylmethyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc2ccccc2[nH]1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C18H26N4O.HI/c1-3-19-18(22(2)12-14-8-9-23-13-14)20-11-16-10-15-6-4-5-7-17(15)21-16;/h4-7,10,14,21H,3,8-9,11-13H2,1-2H3,(H,19,20);1H |
| InChIKey | QKPCOFBTRVMWIK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|