C18H28Cl2IN3O2 — CID 109383595
2-[3-(2,4-dichlorophenoxy)propyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109383595) has the molecular formula C18H28Cl2IN3O2 and a molecular weight of 516.25 g/mol. Its IUPAC name is 2-[3-(2,4-dichlorophenoxy)propyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[3-(2,4-dichlorophenoxy)propyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109383595 |
| Molecular Formula | C18H28Cl2IN3O2 |
| Molecular Weight | 516.25 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | 2-[3-(2,4-dichlorophenoxy)propyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOc1ccc(Cl)cc1Cl)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C18H27Cl2N3O2.HI/c1-3-21-18(23(2)12-14-7-10-24-13-14)22-8-4-9-25-17-6-5-15(19)11-16(17)20;/h5-6,11,14H,3-4,7-10,12-13H2,1-2H3,(H,21,22);1H |
| InChIKey | BPFHNUQIHULTKP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.25 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|