C16H26Cl2IN5O — CID 109384321
2-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109384321) has the molecular formula C16H26Cl2IN5O and a molecular weight of 502.23 g/mol. Its IUPAC name is 2-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109384321 |
| Molecular Formula | C16H26Cl2IN5O |
| Molecular Weight | 502.23 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | 2-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCNc1ncc(Cl)cc1Cl)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C16H25Cl2N5O.HI/c1-3-19-16(23(2)10-12-4-7-24-11-12)21-6-5-20-15-14(18)8-13(17)9-22-15;/h8-9,12H,3-7,10-11H2,1-2H3,(H,19,21)(H,20,22);1H |
| InChIKey | KBHAOULHHJEONG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|