C18H26Cl2N4O2 — CID 109386945
3,4-dichloro-N-[2-[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]ethyl]benzamide (PubChem CID 109386945) has the molecular formula C18H26Cl2N4O2 and a molecular weight of 401.34 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 109386945 |
| Molecular Formula | C18H26Cl2N4O2 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 3,4-dichloro-N-[2-[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]ethyl]benzamide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccc(Cl)c(Cl)c1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C18H26Cl2N4O2/c1-3-21-18(24(2)11-13-6-9-26-12-13)23-8-7-22-17(25)14-4-5-15(19)16(20)10-14/h4-5,10,13H,3,6-9,11-12H2,1-2H3,(H,21,23)(H,22,25) |
| InChIKey | PTJFBRFRFFCCAV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|