C17H28ClIN4O3S — CID 109385075
2-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109385075) has the molecular formula C17H28ClIN4O3S and a molecular weight of 530.86 g/mol. Its IUPAC name is 2-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109385075 |
| Molecular Formula | C17H28ClIN4O3S |
| Molecular Weight | 530.86 g/mol |
| Exact Mass | 530.06 |
| IUPAC Name | 2-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCNS(=O)(=O)c1cccc(Cl)c1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C17H27ClN4O3S.HI/c1-3-19-17(22(2)12-14-7-10-25-13-14)20-8-9-21-26(23,24)16-6-4-5-15(18)11-16;/h4-6,11,14,21H,3,7-10,12-13H2,1-2H3,(H,19,20);1H |
| InChIKey | BWMRBGNDVLSTHT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.86 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|