C19H32IN3O3S — CID 109383513
2-(3-benzylsulfonylpropyl)-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109383513) has the molecular formula C19H32IN3O3S and a molecular weight of 509.45 g/mol. Its IUPAC name is 2-(3-benzylsulfonylpropyl)-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-(3-benzylsulfonylpropyl)-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109383513 |
| Molecular Formula | C19H32IN3O3S |
| Molecular Weight | 509.45 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | 2-(3-benzylsulfonylpropyl)-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCS(=O)(=O)Cc1ccccc1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C19H31N3O3S.HI/c1-3-20-19(22(2)14-18-10-12-25-15-18)21-11-7-13-26(23,24)16-17-8-5-4-6-9-17;/h4-6,8-9,18H,3,7,10-16H2,1-2H3,(H,20,21);1H |
| InChIKey | XIDOHTIUWUYYGA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|