C17H26FN3O — CID 109382760
3-ethyl-2-[2-(3-fluorophenyl)ethyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109382760) has the molecular formula C17H26FN3O and a molecular weight of 307.41 g/mol. Its IUPAC name is 3-ethyl-2-[2-(3-fluorophenyl)ethyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 3-ethyl-2-[2-(3-fluorophenyl)ethyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109382760 |
| Molecular Formula | C17H26FN3O |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 3-ethyl-2-[2-(3-fluorophenyl)ethyl]-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\CCc1cccc(F)c1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C17H26FN3O/c1-3-19-17(21(2)12-15-8-10-22-13-15)20-9-7-14-5-4-6-16(18)11-14/h4-6,11,15H,3,7-10,12-13H2,1-2H3,(H,19,20) |
| InChIKey | QBPGGQDWODKLPE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|